EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22O10 |
| Net Charge | 0 |
| Average Mass | 398.364 |
| Monoisotopic Mass | 398.12130 |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2C[C@@](O)(C(=O)O)C[C@@H](O)[C@@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C18H22O10/c1-26-11-5-9(6-12(27-2)16(11)22)3-4-14(20)28-13-8-18(25,17(23)24)7-10(19)15(13)21/h3-6,10,13,15,19,21-22,25H,7-8H2,1-2H3,(H,23,24)/b4-3+/t10-,13-,15+,18-/m1/s1 |
| InChIKey | DTJWTKVKHOJHJK-LTLLRWTCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-O-sinapoylquinic acid (CHEBI:75493) has functional parent (−)-quinic acid (CHEBI:17521) |
| 3-O-sinapoylquinic acid (CHEBI:75493) has functional parent trans-sinapic acid (CHEBI:15714) |
| 3-O-sinapoylquinic acid (CHEBI:75493) has role metabolite (CHEBI:25212) |
| 3-O-sinapoylquinic acid (CHEBI:75493) is a cinnamate ester (CHEBI:36087) |
| 3-O-sinapoylquinic acid (CHEBI:75493) is a cyclitol carboxylic acid (CHEBI:36123) |
| IUPAC Name |
|---|
| (1R,3R,4S,5R)-1,3,4-trihydroxy-5-{[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]oxy}cyclohexanecarboxylic acid |