EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10N4O4 |
| Net Charge | 0 |
| Average Mass | 214.181 |
| Monoisotopic Mass | 214.07020 |
| SMILES | O=C(Cn1ccnc1[N+](=O)[O-])NCCO |
| InChI | InChI=1S/C7H10N4O4/c12-4-2-8-6(13)5-10-3-1-9-7(10)11(14)15/h1,3,12H,2,4-5H2,(H,8,13) |
| InChIKey | WCDWBPCFGJXFJZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Applications: | radiosensitizing agent A drug that makes increases the sensitivity of tumour cells to radiation therapy. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. prodrug A compound that, on administration, must undergo chemical conversion by metabolic processes before becoming the pharmacologically active drug for which it is a prodrug. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| etanidazole (CHEBI:75473) has functional parent ethanolamine (CHEBI:16000) |
| etanidazole (CHEBI:75473) has role alkylating agent (CHEBI:22333) |
| etanidazole (CHEBI:75473) has role antineoplastic agent (CHEBI:35610) |
| etanidazole (CHEBI:75473) has role prodrug (CHEBI:50266) |
| etanidazole (CHEBI:75473) has role radiosensitizing agent (CHEBI:132992) |
| etanidazole (CHEBI:75473) is a C-nitro compound (CHEBI:35716) |
| etanidazole (CHEBI:75473) is a imidazoles (CHEBI:24780) |
| etanidazole (CHEBI:75473) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| N-(2-hydroxyethyl)-2-(2-nitro-1H-imidazol-1-yl)acetamide |
| INN | Source |
|---|---|
| etanidazole | KEGG DRUG |
| Synonyms | Source |
|---|---|
| N-(2-Hydroxyethyl)-1-(2-nitro-1-imidazolyl)acetamide | ChemIDplus |
| N-(2-Hydroxyethyl)-2-nitroimidazole-1-acetamide | ChemIDplus |
| Etanidazolum | ChemIDplus |
| N-(2-Hydroxyethyl)-2-nitro-1H-imidazole-1-acetamide | ChemIDplus |
| Etanidazol | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D04075 | KEGG DRUG |
| Etanidazole | Wikipedia |
| WO2011109387 | Patent |
| LSM-4774 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:919296 | Reaxys |
| CAS:22668-01-5 | KEGG DRUG |
| CAS:22668-01-5 | ChemIDplus |
| Citations |
|---|