EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O6 |
| Net Charge | 0 |
| Average Mass | 288.255 |
| Monoisotopic Mass | 288.06339 |
| SMILES | O=C(CC(=O)c1c(O)cc(O)cc1O)c1ccc(O)cc1 |
| InChI | InChI=1S/C15H12O6/c16-9-3-1-8(2-4-9)11(18)7-14(21)15-12(19)5-10(17)6-13(15)20/h1-6,16-17,19-20H,7H2 |
| InChIKey | LYBOINSLCFYPDG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,4',6-tetrahydroxydibenzoylmethane (CHEBI:75418) has functional parent dibenzoylmethane (CHEBI:75417) |
| 2,4,4',6-tetrahydroxydibenzoylmethane (CHEBI:75418) has role antineoplastic agent (CHEBI:35610) |
| 2,4,4',6-tetrahydroxydibenzoylmethane (CHEBI:75418) is a aromatic ketone (CHEBI:76224) |
| 2,4,4',6-tetrahydroxydibenzoylmethane (CHEBI:75418) is a β-diketone (CHEBI:67265) |
| IUPAC Name |
|---|
| 1-(4-hydroxyphenyl)-3-(2,4,6-trihydroxyphenyl)propane-1,3-dione |
| Synonym | Source |
|---|---|
| naringenin dibenzoylmethane tautomer | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-12655 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5349904 | Reaxys |
| Citations |
|---|