EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O2 |
| Net Charge | 0 |
| Average Mass | 224.259 |
| Monoisotopic Mass | 224.08373 |
| SMILES | O=C(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | NZZIMKJIVMHWJC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antimutagen An agent that reduces or interferes with the mutagenic actions or effects of a substance. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibenzoylmethane (CHEBI:75417) has role antimutagen (CHEBI:73190) |
| dibenzoylmethane (CHEBI:75417) has role antineoplastic agent (CHEBI:35610) |
| dibenzoylmethane (CHEBI:75417) has role metabolite (CHEBI:25212) |
| dibenzoylmethane (CHEBI:75417) is a aromatic ketone (CHEBI:76224) |
| dibenzoylmethane (CHEBI:75417) is a β-diketone (CHEBI:67265) |
| Incoming Relation(s) |
| 2,4,4',6-tetrahydroxydibenzoylmethane (CHEBI:75418) has functional parent dibenzoylmethane (CHEBI:75417) |
| IUPAC Name |
|---|
| 1,3-diphenylpropane-1,3-dione |
| Synonyms | Source |
|---|---|
| 2-Benzoylacetophenone | ChemIDplus |
| omega-Benzoylacetophenone | ChemIDplus |
| ω-benzoylacetophenone | ChemIDplus |
| 1,3-Diphenyl-1,3-propanedione | ChemIDplus |
| Phenyl phenacyl ketone | ChemIDplus |
| DBM | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Dibenzoylmethane | Wikipedia |
| LSM-2003 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:514910 | Reaxys |
| CAS:120-46-7 | ChemIDplus |
| Citations |
|---|