EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H12O2 |
| Net Charge | 0 |
| Average Mass | 224.259 |
| Monoisotopic Mass | 224.08373 |
| SMILES | O=C(CC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O2/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13/h1-10H,11H2 |
| InChIKey | NZZIMKJIVMHWJC-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimutagen An agent that reduces or interferes with the mutagenic actions or effects of a substance. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dibenzoylmethane (CHEBI:75417) has role antimutagen (CHEBI:73190) |
| dibenzoylmethane (CHEBI:75417) has role antineoplastic agent (CHEBI:35610) |
| dibenzoylmethane (CHEBI:75417) has role metabolite (CHEBI:25212) |
| dibenzoylmethane (CHEBI:75417) is a aromatic ketone (CHEBI:76224) |
| dibenzoylmethane (CHEBI:75417) is a β-diketone (CHEBI:67265) |
| Incoming Relation(s) |
| 2,4,4',6-tetrahydroxydibenzoylmethane (CHEBI:75418) has functional parent dibenzoylmethane (CHEBI:75417) |
| IUPAC Name |
|---|
| 1,3-diphenylpropane-1,3-dione |
| Synonyms | Source |
|---|---|
| 1,3-Diphenyl-1,3-propanedione | ChemIDplus |
| 2-Benzoylacetophenone | ChemIDplus |
| DBM | ChEBI |
| omega-Benzoylacetophenone | ChemIDplus |
| Phenyl phenacyl ketone | ChemIDplus |
| ω-benzoylacetophenone | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Dibenzoylmethane | Wikipedia |
| LSM-2003 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:514910 | Reaxys |
| CAS:120-46-7 | ChemIDplus |
| Citations |
|---|