EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H23Cl6N2O |
| Net Charge | +1 |
| Average Mass | 652.256 |
| Monoisotopic Mass | 648.99361 |
| SMILES | Clc1ccc(C(c2ccc(Cl)cc2)n2cc[n+](CC(OCc3ccc(Cl)cc3Cl)c3ccc(Cl)cc3Cl)c2)cc1 |
| InChI | InChI=1S/C31H23Cl6N2O/c32-23-6-1-20(2-7-23)31(21-3-8-24(33)9-4-21)39-14-13-38(19-39)17-30(27-12-11-26(35)16-29(27)37)40-18-22-5-10-25(34)15-28(22)36/h1-16,19,30-31H,17-18H2/q+1 |
| InChIKey | CTKNMSVWMRRCPW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Roles: | calmodulin antagonist An antagonist that interferes with the action of the calcium-binding messenger protein calmodulin. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calmidazolium (CHEBI:75400) has role apoptosis inducer (CHEBI:68495) |
| calmidazolium (CHEBI:75400) has role calmodulin antagonist (CHEBI:130181) |
| calmidazolium (CHEBI:75400) is a imidazolium ion (CHEBI:59964) |
| Incoming Relation(s) |
| calmidazolium chloride (CHEBI:195198) has part calmidazolium (CHEBI:75400) |
| IUPAC Name |
|---|
| 1-[bis(4-chlorophenyl)methyl]-3-{2-[(2,4-dichlorobenzyl)oxy]-2-(2,4-dichlorophenyl)ethyl}-1H-imidazol-3-ium |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4073265 | Reaxys |
| CAS:95013-41-5 | ChemIDplus |
| Citations |
|---|