EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H23Cl6N2O.Cl |
| Net Charge | 0 |
| Average Mass | 687.709 |
| Monoisotopic Mass | 683.96301 |
| SMILES | Clc1ccc(C(c2ccc(Cl)cc2)n2cc[n+](CC(OCc3ccc(Cl)cc3Cl)c3ccc(Cl)cc3Cl)c2)cc1.[Cl-] |
| InChI | InChI=1S/C31H23Cl6N2O.ClH/c32-23-6-1-20(2-7-23)31(21-3-8-24(33)9-4-21)39-14-13-38(19-39)17-30(27-12-11-26(35)16-29(27)37)40-18-22-5-10-25(34)15-28(22)36;/h1-16,19,30-31H,17-18H2;1H/q+1;/p-1 |
| InChIKey | YGEIMSMISRCBFF-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Biological Roles: | calmodulin antagonist An antagonist that interferes with the action of the calcium-binding messenger protein calmodulin. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| calmidazolium chloride (CHEBI:195198) has part calmidazolium (CHEBI:75400) |
| calmidazolium chloride (CHEBI:195198) has role apoptosis inducer (CHEBI:68495) |
| calmidazolium chloride (CHEBI:195198) has role calmodulin antagonist (CHEBI:130181) |
| calmidazolium chloride (CHEBI:195198) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 1-[bis(4-chlorophenyl)methyl]-3-{2-(2,4-dichlorophenyl)-2-[(2,4-dichlorophenyl)methoxy]ethyl}-1H-imidazol-3-ium chloride |
| Synonyms | Source |
|---|---|
| 1-[bis(4-chlorophenyl)methyl]-3-[2-(2,4-dichlorophenyl)-2-(2,4-dichlorobenzyloxy)ethyl]-1H-imidazolium chloride | ChEBI |
| calmidazolium (chloride) | ChEBI |
| R 24571 | ChEBI |
| R-24571 | ChEBI |
| R24571 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:57265-65-3 | SUBMITTER |
| Citations |
|---|