EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16ClNO4S |
| Net Charge | 0 |
| Average Mass | 377.849 |
| Monoisotopic Mass | 377.04886 |
| SMILES | COC(=O)c1cc2cc(S(C)(=O)=O)ccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClNO4S/c1-24-18(21)17-10-13-9-15(25(2,22)23)7-8-16(13)20(17)11-12-3-5-14(19)6-4-12/h3-10H,11H2,1-2H3 |
| InChIKey | UBZBOEWMQPWUKB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | cyclooxygenase 2 inhibitor A cyclooxygenase inhibitor that interferes with the action of cyclooxygenase 2. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| LM-1685 (CHEBI:75392) has role cyclooxygenase 2 inhibitor (CHEBI:50629) |
| LM-1685 (CHEBI:75392) is a indolyl carboxylate ester (CHEBI:46939) |
| LM-1685 (CHEBI:75392) is a methyl ester (CHEBI:25248) |
| LM-1685 (CHEBI:75392) is a monochlorobenzenes (CHEBI:83403) |
| LM-1685 (CHEBI:75392) is a sulfone (CHEBI:35850) |
| IUPAC Name |
|---|
| methyl 1-(4-chlorobenzyl)-5-(methylsulfonyl)-1H-indole-2-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| LSM-5626 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9144620 | Reaxys |
| Citations |
|---|