EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23O10P |
| Net Charge | 0 |
| Average Mass | 454.368 |
| Monoisotopic Mass | 454.10288 |
| SMILES | CC(=O)OCOC(c1ccc2ccccc2c1)P(=O)(OCOC(C)=O)OCOC(C)=O |
| InChI | InChI=1S/C20H23O10P/c1-14(21)25-11-28-20(19-9-8-17-6-4-5-7-18(17)10-19)31(24,29-12-26-15(2)22)30-13-27-16(3)23/h4-10,20H,11-13H2,1-3H3 |
| InChIKey | UQODAZKXEREJLZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hydroxy-2-naphthalenyl-methyl phosphonic acid trisacetoxymethylester (CHEBI:75391) has functional parent hydroxymethylphosphonic acid (CHEBI:5810) |
| hydroxy-2-naphthalenyl-methyl phosphonic acid trisacetoxymethylester (CHEBI:75391) has role tyrosine kinase inhibitor (CHEBI:38637) |
| hydroxy-2-naphthalenyl-methyl phosphonic acid trisacetoxymethylester (CHEBI:75391) is a acetate ester (CHEBI:47622) |
| hydroxy-2-naphthalenyl-methyl phosphonic acid trisacetoxymethylester (CHEBI:75391) is a naphthalenes (CHEBI:25477) |
| hydroxy-2-naphthalenyl-methyl phosphonic acid trisacetoxymethylester (CHEBI:75391) is a organic phosphonate (CHEBI:37592) |
| Synonyms | Source |
|---|---|
| 3-[(acetyloxy)methoxy]-4-(naphthalen-2-yl)-3-oxido-8-oxo-2,5,7-trioxa-3λ5-phosphanon-1-yl acetate | ChEBI |
| HNMPA-(AM)3 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LSM-6443 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11322049 | Reaxys |
| Citations |
|---|