EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O3S |
| Net Charge | 0 |
| Average Mass | 292.360 |
| Monoisotopic Mass | 292.08816 |
| SMILES | CCOC(=O)C1=C(C)NC(=S)N[C@@H]1c1cccc(O)c1 |
| InChI | InChI=1S/C14H16N2O3S/c1-3-19-13(18)11-8(2)15-14(20)16-12(11)9-5-4-6-10(17)7-9/h4-7,12,17H,3H2,1-2H3,(H2,15,16,20)/t12-/m1/s1 |
| InChIKey | LOBCDGHHHHGHFA-GFCCVEGCSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-monastrol (CHEBI:75383) is a ethyl 4-(3-hydroxyphenyl)-6-methyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate (CHEBI:143544) |
| (R)-monastrol (CHEBI:75383) is enantiomer of (S)-monastrol (CHEBI:75384) |
| Incoming Relation(s) |
| monastrol (CHEBI:75382) has part (R)-monastrol (CHEBI:75383) |
| (S)-monastrol (CHEBI:75384) is enantiomer of (R)-monastrol (CHEBI:75383) |
| IUPAC Name |
|---|
| ethyl (4R)-4-(3-hydroxyphenyl)-6-methyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8497709 | Reaxys |