EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75382 - monastrol
| Formula | C14H16N2O3S |
| Net Charge | 0 |
| Average Mass | 292.360 |
| Monoisotopic Mass | 292.08816 |
| SMILES | CCOC(=O)C1=C(C)NC(=S)NC1c1cccc(O)c1 |
| InChI | InChI=1S/C14H16N2O3S/c1-3-19-13(18)11-8(2)15-14(20)16-12(11)9-5-4-6-10(17)7-9/h4-7,12,17H,3H2,1-2H3,(H2,15,16,20) |
| InChIKey | LOBCDGHHHHGHFA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.5.1.5 (urease) inhibitor EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the activity of urease (EC 3.5.1.5), reducing hydrolysis. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antimitotic Any compound that inhibits cell division (mitosis). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monastrol (CHEBI:75382) has part (R)-monastrol (CHEBI:75383) |
| monastrol (CHEBI:75382) has part (S)-monastrol (CHEBI:75384) |
| monastrol (CHEBI:75382) has role antileishmanial agent (CHEBI:70868) |
| monastrol (CHEBI:75382) has role antimitotic (CHEBI:64911) |
| monastrol (CHEBI:75382) has role antineoplastic agent (CHEBI:35610) |
| monastrol (CHEBI:75382) has role EC 3.5.1.5 (urease) inhibitor (CHEBI:50635) |
| monastrol (CHEBI:75382) is a racemate (CHEBI:60911) |
| IUPAC Name |
|---|
| rac-ethyl 4-(3-hydroxyphenyl)-6-methyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| Monastrol | Wikipedia |
| CN101781259 | Patent |
| LSM-1809 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8495831 | Reaxys |
| Citations |
|---|