EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H16N2O3S |
| Net Charge | 0 |
| Average Mass | 292.360 |
| Monoisotopic Mass | 292.08816 |
| SMILES | CCOC(=O)C1=C(C)NC(=S)NC1c1cccc(O)c1 |
| InChI | InChI=1S/C14H16N2O3S/c1-3-19-13(18)11-8(2)15-14(20)16-12(11)9-5-4-6-10(17)7-9/h4-7,12,17H,3H2,1-2H3,(H2,15,16,20) |
| InChIKey | LOBCDGHHHHGHFA-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | EC 3.5.1.5 (urease) inhibitor EC 3.5.1.* (non-peptide linear amide C-N hydrolase) inhibitor that interferes with the activity of urease (EC 3.5.1.5), reducing hydrolysis. antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antimitotic Any compound that inhibits cell division (mitosis). |
| Applications: | antileishmanial agent An antiprotozoal drug used to treat or prevent infections caused by protozoan parasites that belong to the genus Leishmania. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| monastrol (CHEBI:75382) has part (R)-monastrol (CHEBI:75383) |
| monastrol (CHEBI:75382) has part (S)-monastrol (CHEBI:75384) |
| monastrol (CHEBI:75382) has role antileishmanial agent (CHEBI:70868) |
| monastrol (CHEBI:75382) has role antimitotic (CHEBI:64911) |
| monastrol (CHEBI:75382) has role antineoplastic agent (CHEBI:35610) |
| monastrol (CHEBI:75382) has role EC 3.5.1.5 (urease) inhibitor (CHEBI:50635) |
| monastrol (CHEBI:75382) is a racemate (CHEBI:60911) |
| IUPAC Name |
|---|
| rac-ethyl 4-(3-hydroxyphenyl)-6-methyl-2-thioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylate |
| Manual Xrefs | Databases |
|---|---|
| CN101781259 | Patent |
| LSM-1809 | LINCS |
| Monastrol | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8495831 | Reaxys |
| Citations |
|---|