EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H8Cl2O3 |
| Net Charge | 0 |
| Average Mass | 235.066 |
| Monoisotopic Mass | 233.98505 |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)O |
| InChI | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13)/t5-/m1/s1 |
| InChIKey | MZHCENGPTKEIGP-RXMQYKEDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | synthetic auxin A synthetic compound exhibiting auxin activity. EC 1.11.1.6 (catalase) inhibitor An inhibitor of peroxidases (EC 1.11.1.*) that inhibits the action of catalase (EC 1.11.1.6). |
| Applications: | phenoxy herbicide Any member of the class of herbicides whose members contain a phenoxy or substituted phenoxy group. agrochemical An agrochemical is a substance that is used in agriculture or horticulture. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-dichlorprop (CHEBI:75373) has role agrochemical (CHEBI:33286) |
| (R)-dichlorprop (CHEBI:75373) has role EC 1.11.1.6 (catalase) inhibitor (CHEBI:75380) |
| (R)-dichlorprop (CHEBI:75373) has role phenoxy herbicide (CHEBI:60575) |
| (R)-dichlorprop (CHEBI:75373) has role synthetic auxin (CHEBI:26841) |
| (R)-dichlorprop (CHEBI:75373) is a 2-(2,4-dichlorophenoxy)propanoic acid (CHEBI:75370) |
| (R)-dichlorprop (CHEBI:75373) is conjugate acid of (R)-dichlorprop(1−) (CHEBI:75288) |
| (R)-dichlorprop (CHEBI:75373) is enantiomer of (S)-dichlorprop (CHEBI:75374) |
| Incoming Relation(s) |
| dichlorprop (CHEBI:75375) has part (R)-dichlorprop (CHEBI:75373) |
| (R)-dichlorprop(1−) (CHEBI:75288) is conjugate base of (R)-dichlorprop (CHEBI:75373) |
| (S)-dichlorprop (CHEBI:75374) is enantiomer of (R)-dichlorprop (CHEBI:75373) |
| IUPAC Name |
|---|
| (2R)-2-(2,4-dichlorophenoxy)propanoic acid |
| Synonyms | Source |
|---|---|
| (+)-2-(2,4-dichlorophenoxy)propanoic acid | ChEBI |
| (+)-2-(2,4-dichlorophenoxy)propionic acid | ChEBI |
| (+)-2,4-DP | ChemIDplus |
| (2R)-(+)-2-(2,4-dichlorophenoxy)propanoic acid | ChEBI |
| (2R)-(+)-2-(2,4-dichlorophenoxy)propionic acid | ChEBI |
| (2R)-2-(2,4-dichlorophenoxy)propionic acid | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 219 | PPDB |
| dichlorprop-p | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3203101 | Reaxys |
| CAS:15165-67-0 | ChemIDplus |
| Citations |
|---|