EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7Cl2O3 |
| Net Charge | -1 |
| Average Mass | 234.058 |
| Monoisotopic Mass | 232.97777 |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)[O-] |
| InChI | InChI=1S/C9H8Cl2O3/c1-5(9(12)13)14-8-3-2-6(10)4-7(8)11/h2-5H,1H3,(H,12,13)/p-1/t5-/m1/s1 |
| InChIKey | MZHCENGPTKEIGP-RXMQYKEDSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-dichlorprop(1−) (CHEBI:75288) is a monocarboxylic acid anion (CHEBI:35757) |
| (R)-dichlorprop(1−) (CHEBI:75288) is conjugate base of (R)-dichlorprop (CHEBI:75373) |
| (R)-dichlorprop(1−) (CHEBI:75288) is enantiomer of (S)-dichlorprop(1−) (CHEBI:75287) |
| Incoming Relation(s) |
| (R)-dichlorprop (CHEBI:75373) is conjugate acid of (R)-dichlorprop(1−) (CHEBI:75288) |
| (S)-dichlorprop(1−) (CHEBI:75287) is enantiomer of (R)-dichlorprop(1−) (CHEBI:75288) |
| IUPAC Name |
|---|
| (2R)-2-(2,4-dichlorophenoxy)propanoate |
| Synonym | Source |
|---|---|
| (R)-(2,4-dichlorophenoxy)propionate | ChEBI |
| UniProt Name | Source |
|---|---|
| (R)-(2,4-dichlorophenoxy)propanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-15728 | MetaCyc |
| Citations |
|---|