EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H18ClN2O2S |
| Net Charge | +1 |
| Average Mass | 313.830 |
| Monoisotopic Mass | 313.07720 |
| SMILES | [NH3+]CCCCNS(=O)(=O)c1ccc2c(Cl)cccc2c1 |
| InChI | InChI=1S/C14H17ClN2O2S/c15-14-5-3-4-11-10-12(6-7-13(11)14)20(18,19)17-9-2-1-8-16/h3-7,10,17H,1-2,8-9,16H2/p+1 |
| InChIKey | JJQKICOADUKSNS-UHFFFAOYSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide(1+) (CHEBI:75369) is a ammonium ion derivative (CHEBI:35274) |
| N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide(1+) (CHEBI:75369) is a organic cation (CHEBI:25697) |
| N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide(1+) (CHEBI:75369) is conjugate acid of N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide (CHEBI:75366) |
| Incoming Relation(s) |
| N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide hydrochloride (CHEBI:75367) has part N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide(1+) (CHEBI:75369) |
| N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide (CHEBI:75366) is conjugate base of N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide(1+) (CHEBI:75369) |
| IUPAC Name |
|---|
| 4-{[(5-chloronaphthalen-2-yl)sulfonyl]amino}butan-1-aminium |