EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17ClN2O2S |
| Net Charge | 0 |
| Average Mass | 312.822 |
| Monoisotopic Mass | 312.06993 |
| SMILES | NCCCCNS(=O)(=O)c1ccc2c(Cl)cccc2c1 |
| InChI | InChI=1S/C14H17ClN2O2S/c15-14-5-3-4-11-10-12(6-7-13(11)14)20(18,19)17-9-2-1-8-16/h3-7,10,17H,1-2,8-9,16H2 |
| InChIKey | JJQKICOADUKSNS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide (CHEBI:75366) is a naphthalenes (CHEBI:25477) |
| N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide (CHEBI:75366) is a organochlorine compound (CHEBI:36683) |
| N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide (CHEBI:75366) is a primary amino compound (CHEBI:50994) |
| N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide (CHEBI:75366) is a sulfonamide (CHEBI:35358) |
| N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide (CHEBI:75366) is conjugate base of N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide(1+) (CHEBI:75369) |
| Incoming Relation(s) |
| N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide(1+) (CHEBI:75369) is conjugate acid of N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide (CHEBI:75366) |
| IUPAC Name |
|---|
| N-(4-aminobutyl)-5-chloronaphthalene-2-sulfonamide |
| Synonyms | Source |
|---|---|
| W-13 | ChemIDplus |
| W13 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| LSM-2991 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6227387 | Reaxys |
| CAS:81705-04-6 | ChemIDplus |