EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H34O16 |
| Net Charge | 0 |
| Average Mass | 698.630 |
| Monoisotopic Mass | 698.18469 |
| SMILES | COc1cc(/C=C/C(=O)OC[C@H]2OC(Oc3cc(O)c4c(=O)cc(-c5cc(OC)c(O)c(OC)c5)oc4c3)[C@H](O)[C@@H](O)[C@@H]2O)cc(OC)c1O |
| InChI | InChI=1S/C34H34O16/c1-43-22-7-15(8-23(44-2)29(22)38)5-6-27(37)47-14-26-31(40)32(41)33(42)34(50-26)48-17-11-18(35)28-19(36)13-20(49-21(28)12-17)16-9-24(45-3)30(39)25(10-16)46-4/h5-13,26,31-35,38-42H,14H2,1-4H3/b6-5+/t26-,31-,32+,33-,34?/m1/s1 |
| InChIKey | XVUNCAZNCGHDHS-XICCDIAPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricin 7-O-[sinapoyl]-glucoside (CHEBI:75353) has functional parent trans-sinapic acid (CHEBI:15714) |
| tricin 7-O-[sinapoyl]-glucoside (CHEBI:75353) has functional parent tricin 7-O-glucoside (CHEBI:75349) |
| tricin 7-O-[sinapoyl]-glucoside (CHEBI:75353) has role metabolite (CHEBI:25212) |
| tricin 7-O-[sinapoyl]-glucoside (CHEBI:75353) is a D-glucoside (CHEBI:35436) |
| tricin 7-O-[sinapoyl]-glucoside (CHEBI:75353) is a cinnamate ester (CHEBI:36087) |
| tricin 7-O-[sinapoyl]-glucoside (CHEBI:75353) is a dihydroxyflavone (CHEBI:38686) |
| tricin 7-O-[sinapoyl]-glucoside (CHEBI:75353) is a dimethoxyflavone (CHEBI:23798) |
| tricin 7-O-[sinapoyl]-glucoside (CHEBI:75353) is a glycosyloxyflavone (CHEBI:50018) |
| tricin 7-O-[sinapoyl]-glucoside (CHEBI:75353) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxo-4H-chromen-7-yl 6-O-[(2E)-3-(4-hydroxy-3,5-dimethoxyphenyl)prop-2-enoyl]-D-glucopyranoside |