EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H24O12 |
| Net Charge | 0 |
| Average Mass | 492.433 |
| Monoisotopic Mass | 492.12678 |
| SMILES | COc1cc(-c2cc(=O)c3c(O)cc(OC4O[C@H](CO)[C@@H](O)[C@H](O)[C@H]4O)cc3o2)cc(OC)c1O |
| InChI | InChI=1S/C23H24O12/c1-31-15-3-9(4-16(32-2)19(15)27)13-7-12(26)18-11(25)5-10(6-14(18)34-13)33-23-22(30)21(29)20(28)17(8-24)35-23/h3-7,17,20-25,27-30H,8H2,1-2H3/t17-,20-,21+,22-,23?/m1/s1 |
| InChIKey | JGXFMIJHKASCIZ-NODAHLOSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tricin 7-O-glucoside (CHEBI:75349) has functional parent 3',5'-di-O-methyltricetin (CHEBI:59979) |
| tricin 7-O-glucoside (CHEBI:75349) has role metabolite (CHEBI:25212) |
| tricin 7-O-glucoside (CHEBI:75349) is a D-glucoside (CHEBI:35436) |
| tricin 7-O-glucoside (CHEBI:75349) is a dihydroxyflavone (CHEBI:38686) |
| tricin 7-O-glucoside (CHEBI:75349) is a dimethoxyflavone (CHEBI:23798) |
| tricin 7-O-glucoside (CHEBI:75349) is a glycosyloxyflavone (CHEBI:50018) |
| tricin 7-O-glucoside (CHEBI:75349) is a monosaccharide derivative (CHEBI:63367) |
| Incoming Relation(s) |
| tricin 7-O-[sinapoyl]-glucoside (CHEBI:75353) has functional parent tricin 7-O-glucoside (CHEBI:75349) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(4-hydroxy-3,5-dimethoxyphenyl)-4-oxo-4H-chromen-7-yl D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 2,4-dichloro-6-(O-chlorophenoxy)-S-triazine | HMDB |
| Tricin 7-glucoside | HMDB |
| Glucotricin | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0030553 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5785058 | Reaxys |
| Citations |
|---|