EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H9Br3O4 |
| Net Charge | 0 |
| Average Mass | 516.967 |
| Monoisotopic Mass | 513.80510 |
| SMILES | C#CCOC(=O)c1ccccc1C(=O)Oc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C17H9Br3O4/c1-2-7-23-16(21)11-5-3-4-6-12(11)17(22)24-15-13(19)8-10(18)9-14(15)20/h1,3-6,8-9H,7H2 |
| InChIKey | GAVHNVOEKPQQEY-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | endocrine disruptor Any compound that can disrupt the functions of the endocrine (hormone) system |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-propyn-1-yl 2,4,6-tribromophenyl phthalate (CHEBI:75345) has functional parent 2,4,6-tribromophenol (CHEBI:47696) |
| 2-propyn-1-yl 2,4,6-tribromophenyl phthalate (CHEBI:75345) has functional parent prop-2-yn-1-ol (CHEBI:28905) |
| 2-propyn-1-yl 2,4,6-tribromophenyl phthalate (CHEBI:75345) is a organobromine compound (CHEBI:37141) |
| 2-propyn-1-yl 2,4,6-tribromophenyl phthalate (CHEBI:75345) is a phthalate ester (CHEBI:35484) |
| 2-propyn-1-yl 2,4,6-tribromophenyl phthalate (CHEBI:75345) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| prop-2-yn-1-yl 2,4,6-tribromophenyl phthalate |