EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:47696 - 2,4,6-tribromophenol
| Formula | C6H3Br3O |
| Net Charge | 0 |
| Average Mass | 330.801 |
| Monoisotopic Mass | 327.77340 |
| SMILES | Oc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C6H3Br3O/c7-3-1-4(8)6(10)5(9)2-3/h1-2,10H |
| InChIKey | BSWWXRFVMJHFBN-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Neosiphonia sphaerocarpa (WORMS:146348) | - | PubMed (10656411) | |
| Grateloupia elliptica (ncbitaxon:118371) | - | PubMed (18951591) |
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. fungicide A substance used to destroy fungal pests. |
| Application: | fungicide A substance used to destroy fungal pests. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4,6-tribromophenol (CHEBI:47696) has role environmental contaminant (CHEBI:78298) |
| 2,4,6-tribromophenol (CHEBI:47696) has role fungicide (CHEBI:24127) |
| 2,4,6-tribromophenol (CHEBI:47696) has role marine metabolite (CHEBI:76507) |
| 2,4,6-tribromophenol (CHEBI:47696) is a bromophenol (CHEBI:33624) |
| Incoming Relation(s) |
| 2-propyn-1-yl 2,4,6-tribromophenyl phthalate (CHEBI:75345) has functional parent 2,4,6-tribromophenol (CHEBI:47696) |
| Synonyms | Source |
|---|---|
| Tribromophenol | ChemIDplus |
| Bromol | ChemIDplus |
| Xeroform | ChemIDplus |
| 2,4,6-TBP | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C14454 | KEGG COMPOUND |
| TBP | PDBeChem |
| DB02417 | DrugBank |
| HMDB0029642 | HMDB |
| 2,4,6-tribromophenol | Wikipedia |
| Citations |
|---|