EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:75320 - 2-amino-5-chloro-cis,cis-muconic 6-semialdehyde
| Formula | C6H6ClNO3 |
| Net Charge | 0 |
| Average Mass | 175.571 |
| Monoisotopic Mass | 175.00362 |
| SMILES | [H]C(=O)/C(Cl)=C\C=C(\N)C(=O)O |
| InChI | InChI=1S/C6H6ClNO3/c7-4(3-9)1-2-5(8)6(10)11/h1-3H,8H2,(H,10,11)/b4-1+,5-2+ |
| InChIKey | YEIFVAPTZWXPNE-GRSRPBPQSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-5-chloro-cis,cis-muconic 6-semialdehyde (CHEBI:75320) has role metabolite (CHEBI:25212) |
| 2-amino-5-chloro-cis,cis-muconic 6-semialdehyde (CHEBI:75320) is a muconic semialdehyde (CHEBI:38436) |
| 2-amino-5-chloro-cis,cis-muconic 6-semialdehyde (CHEBI:75320) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| 2-amino-5-chloro-cis,cis-muconic 6-semialdehyde (CHEBI:75320) is a organochlorine compound (CHEBI:36683) |
| 2-amino-5-chloro-cis,cis-muconic 6-semialdehyde (CHEBI:75320) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| 2-amino-5-chloro-cis,cis-muconic 6-semialdehyde (CHEBI:75320) is tautomer of 2-amino-5-chloro-cis,cis-muconate 6-semialdehyde zwitterion (CHEBI:75057) |
| Incoming Relation(s) |
| 2-amino-5-chloro-cis,cis-muconate 6-semialdehyde zwitterion (CHEBI:75057) is tautomer of 2-amino-5-chloro-cis,cis-muconic 6-semialdehyde (CHEBI:75320) |
| IUPAC Name |
|---|
| (2E,4E)-2-amino-5-chloro-6-oxohexa-2,4-dienoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-9161 | MetaCyc |
| Citations |
|---|