EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24N2O9 |
| Net Charge | 0 |
| Average Mass | 340.329 |
| Monoisotopic Mass | 340.14818 |
| SMILES | N[C@@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C12H24N2O9/c13-5-7(17)3(1-15)21-11(9(5)19)23-12-10(20)6(14)8(18)4(2-16)22-12/h3-12,15-20H,1-2,13-14H2/t3-,4-,5+,6+,7-,8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | ZPEFXARQZVAHGO-DCSYEGIMSA-N |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3'-neotrehalosadiamine (CHEBI:75319) has role antimicrobial agent (CHEBI:33281) |
| 3,3'-neotrehalosadiamine (CHEBI:75319) has role metabolite (CHEBI:25212) |
| 3,3'-neotrehalosadiamine (CHEBI:75319) is a amino disaccharide (CHEBI:22480) |
| 3,3'-neotrehalosadiamine (CHEBI:75319) is a glycosyl glycoside derivative (CHEBI:63356) |
| 3,3'-neotrehalosadiamine (CHEBI:75319) is conjugate base of 3,3'-neotrehalosadiamine(2+) (CHEBI:75053) |
| Incoming Relation(s) |
| 3,3'-neotrehalosadiamine(2+) (CHEBI:75053) is conjugate acid of 3,3'-neotrehalosadiamine (CHEBI:75319) |
| IUPAC Name |
|---|
| 3-amino-3-deoxy-β-D-glucopyranosyl 3-amino-3-deoxy-α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| 3,3'-Diamino-3,3'-dideoxy-alpha,beta-trehalose | ChemIDplus |
| β-D-Glc3N-(1↔1)-α-D-Gl3N | ChEBI |
| β-D-kanosaminyl-(1↔1)-α-D-kanosamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:23730595 | Reaxys |
| CAS:104196-14-7 | ChemIDplus |
| Citations |
|---|