EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H26N2O9 |
| Net Charge | +2 |
| Average Mass | 342.345 |
| Monoisotopic Mass | 342.16273 |
| SMILES | [NH3+][C@@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H]([NH3+])[C@H]2O)O[C@H](CO)[C@H]1O |
| InChI | InChI=1S/C12H24N2O9/c13-5-7(17)3(1-15)21-11(9(5)19)23-12-10(20)6(14)8(18)4(2-16)22-12/h3-12,15-20H,1-2,13-14H2/p+2/t3-,4-,5+,6+,7-,8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | ZPEFXARQZVAHGO-DCSYEGIMSA-P |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,3'-neotrehalosadiamine(2+) (CHEBI:75053) is a ammonium ion derivative (CHEBI:35274) |
| 3,3'-neotrehalosadiamine(2+) (CHEBI:75053) is a organic cation (CHEBI:25697) |
| 3,3'-neotrehalosadiamine(2+) (CHEBI:75053) is conjugate acid of 3,3'-neotrehalosadiamine (CHEBI:75319) |
| Incoming Relation(s) |
| 3,3'-neotrehalosadiamine (CHEBI:75319) is conjugate base of 3,3'-neotrehalosadiamine(2+) (CHEBI:75053) |
| IUPAC Name |
|---|
| 3-azaniumyl-3-deoxy-β-D-glucopyranosyl 3-azaniumyl-3-deoxy-α-D-glucopyranoside |
| Citations |
|---|