EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26O3 |
| Net Charge | 0 |
| Average Mass | 302.414 |
| Monoisotopic Mass | 302.18819 |
| SMILES | [H][C@@]12CCC3=CC(=O)CC[C@]3(C=O)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C19H26O3/c1-18-8-7-16-14(15(18)4-5-17(18)22)3-2-12-10-13(21)6-9-19(12,16)11-20/h10-11,14-17,22H,2-9H2,1H3/t14-,15-,16-,17-,18-,19+/m0/s1 |
| InChIKey | TXNCGXATKOMEQC-KOUJMVCDSA-N |
| Roles Classification |
|---|
| Biological Role: | androgen A sex hormone that stimulates or controls the development and maintenance of masculine characteristics in vertebrates by binding to androgen receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 19-oxotestosterone (CHEBI:75308) has functional parent testosterone (CHEBI:17347) |
| 19-oxotestosterone (CHEBI:75308) has role androgen (CHEBI:50113) |
| 19-oxotestosterone (CHEBI:75308) is a 17β-hydroxy steroid (CHEBI:35343) |
| 19-oxotestosterone (CHEBI:75308) is a 3-oxo steroid (CHEBI:47788) |
| 19-oxotestosterone (CHEBI:75308) is a androstanoid (CHEBI:50402) |
| 19-oxotestosterone (CHEBI:75308) is a steroid aldehyde (CHEBI:131565) |
| IUPAC Name |
|---|
| (17β)-17-hydroxy-3-oxoandrost-4-en-19-al |
| UniProt Name | Source |
|---|---|
| 19-oxotestosterone | UniProt |
| Manual Xrefs | Databases |
|---|---|
| C05295 | KEGG COMPOUND |
| HMDB0003959 | HMDB |
| 19-OXO-TESTOSTERONE | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5980492 | Reaxys |
| Citations |
|---|