EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38N2O4 |
| Net Charge | 0 |
| Average Mass | 478.633 |
| Monoisotopic Mass | 478.28316 |
| SMILES | [H][C@]12C=C[C@@]3([H])[C@H](CC)[C@H](C)C[C@]3([H])[C@@]1([H])C[C@@]1([H])/C=C/C(=O)C3=C(O)[C@]([H])(CCCNC(=O)/C=C\C[C@]21[H])NC3=O |
| InChI | InChI=1S/C29H38N2O4/c1-3-18-16(2)14-22-20(18)10-11-21-19-6-4-8-26(33)30-13-5-7-24-28(34)27(29(35)31-24)25(32)12-9-17(19)15-23(21)22/h4,8-12,16-24,34H,3,5-7,13-15H2,1-2H3,(H,30,33)(H,31,35)/b8-4-,12-9+/t16-,17-,18-,19+,20+,21-,22+,23+,24+/m1/s1 |
| InChIKey | WSUGGLXIPUHOSG-QOMLVTEJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces phaeochromogenes (ncbitaxon:1923) | - | PubMed (4625358) | Strain: var. ikaruganensis |
| Streptomyces sp. MDG-04-17-069 (ncbitaxon:698778) | cell suspension culture (BTO:0000221) | PubMed (19968258) |
| Roles Classification |
|---|
| Biological Roles: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ikarugamycin (CHEBI:75276) has role antimicrobial agent (CHEBI:33281) |
| ikarugamycin (CHEBI:75276) has role antineoplastic agent (CHEBI:35610) |
| ikarugamycin (CHEBI:75276) has role antiprotozoal drug (CHEBI:35820) |
| ikarugamycin (CHEBI:75276) has role apoptosis inducer (CHEBI:68495) |
| ikarugamycin (CHEBI:75276) has role bacterial metabolite (CHEBI:76969) |
| ikarugamycin (CHEBI:75276) is a azamacrocycle (CHEBI:52898) |
| ikarugamycin (CHEBI:75276) is a enone (CHEBI:51689) |
| ikarugamycin (CHEBI:75276) is a lactam (CHEBI:24995) |
| ikarugamycin (CHEBI:75276) is a organic heteropentacyclic compound (CHEBI:38164) |
| ikarugamycin (CHEBI:75276) is a polyketide (CHEBI:26188) |
| Incoming Relation(s) |
| butremycin (CHEBI:152570) has functional parent ikarugamycin (CHEBI:75276) |
| IUPAC Name |
|---|
| (2R,3R,3aS,5aR,5bS,7Z,14S,19E,20aS,21aR,21bR)-3-ethyl-22-hydroxy-2-methyl-2,3,3a,5a,5b,6,10,11,12,13,14,15,20a,21,21a,21b-hexadecahydro-1H-14,17-(metheno)-as-indaceno[3,2-k][1,6]diazacycloheptadecine-9,16,18(17H)-trione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:771794 | Reaxys |
| CAS:36531-78-9 | ChemIDplus |
| Citations |
|---|