EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38N2O4 |
| Net Charge | 0 |
| Average Mass | 478.633 |
| Monoisotopic Mass | 478.28316 |
| SMILES | [H][C@]12C=C[C@@]3([H])[C@H](CC)[C@H](C)C[C@]3([H])[C@@]1([H])C[C@@]1([H])/C=C/C(=O)C3=C(O)[C@]([H])(CCCNC(=O)/C=C\C[C@]21[H])NC3=O |
| InChI | InChI=1S/C29H38N2O4/c1-3-18-16(2)14-22-20(18)10-11-21-19-6-4-8-26(33)30-13-5-7-24-28(34)27(29(35)31-24)25(32)12-9-17(19)15-23(21)22/h4,8-12,16-24,34H,3,5-7,13-15H2,1-2H3,(H,30,33)(H,31,35)/b8-4-,12-9+/t16-,17-,18-,19+,20+,21-,22+,23+,24+/m1/s1 |
| InChIKey | WSUGGLXIPUHOSG-QOMLVTEJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Streptomyces phaeochromogenes (ncbitaxon:1923) | - | PubMed (4625358) | Strain: var. ikaruganensis |
| Streptomyces sp. MDG-04-17-069 (ncbitaxon:698778) | cell suspension culture (BTO:0000221) | PubMed (19968258) |
| Roles Classification |
|---|
| Biological Roles: | apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antiprotozoal drug Any antimicrobial drug which is used to treat or prevent protozoal infections. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ikarugamycin (CHEBI:75276) has role antimicrobial agent (CHEBI:33281) |
| ikarugamycin (CHEBI:75276) has role antineoplastic agent (CHEBI:35610) |
| ikarugamycin (CHEBI:75276) has role antiprotozoal drug (CHEBI:35820) |
| ikarugamycin (CHEBI:75276) has role apoptosis inducer (CHEBI:68495) |
| ikarugamycin (CHEBI:75276) has role bacterial metabolite (CHEBI:76969) |
| ikarugamycin (CHEBI:75276) is a azamacrocycle (CHEBI:52898) |
| ikarugamycin (CHEBI:75276) is a enone (CHEBI:51689) |
| ikarugamycin (CHEBI:75276) is a lactam (CHEBI:24995) |
| ikarugamycin (CHEBI:75276) is a organic heteropentacyclic compound (CHEBI:38164) |
| ikarugamycin (CHEBI:75276) is a polyketide (CHEBI:26188) |
| Incoming Relation(s) |
| butremycin (CHEBI:152570) has functional parent ikarugamycin (CHEBI:75276) |
| IUPAC Name |
|---|
| (2R,3R,3aS,5aR,5bS,7Z,14S,19E,20aS,21aR,21bR)-3-ethyl-22-hydroxy-2-methyl-2,3,3a,5a,5b,6,10,11,12,13,14,15,20a,21,21a,21b-hexadecahydro-1H-14,17-(metheno)-as-indaceno[3,2-k][1,6]diazacycloheptadecine-9,16,18(17H)-trione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:771794 | Reaxys |
| CAS:36531-78-9 | ChemIDplus |
| Citations |
|---|