EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H38N2O5 |
| Net Charge | 0 |
| Average Mass | 494.632 |
| Monoisotopic Mass | 494.27807 |
| SMILES | [H][C@]12C=C[C@@]3([H])[C@H](CC)[C@H](C)C[C@]3([H])[C@@]1([H])C[C@@]1([H])/C=C/C(=O)C3=C(O)[C@@]([H])(NC3=O)[C@H](O)CCNC(=O)/C=C\C[C@]21[H] |
| InChI | InChI=1S/C29H38N2O5/c1-3-17-15(2)13-21-19(17)8-9-20-18-5-4-6-25(34)30-12-11-24(33)27-28(35)26(29(36)31-27)23(32)10-7-16(18)14-22(20)21/h4,6-10,15-22,24,27,33,35H,3,5,11-14H2,1-2H3,(H,30,34)(H,31,36)/b6-4-,10-7+/t15-,16-,17-,18+,19+,20-,21+,22+,24-,27+/m1/s1 |
| InChIKey | IJOMIIDEKGZJJF-KSCHHOEWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Micromonospora sp. (ncbitaxon:1876) | cell suspension culture (BTO:0000221) | PubMed (24534843) | Strain: K310 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. marine metabolite Any metabolite produced during a metabolic reaction in marine macro- and microorganisms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| butremycin (CHEBI:152570) has functional parent ikarugamycin (CHEBI:75276) |
| butremycin (CHEBI:152570) has role antibacterial agent (CHEBI:33282) |
| butremycin (CHEBI:152570) has role bacterial metabolite (CHEBI:76969) |
| butremycin (CHEBI:152570) has role marine metabolite (CHEBI:76507) |
| butremycin (CHEBI:152570) is a azamacrocycle (CHEBI:52898) |
| butremycin (CHEBI:152570) is a enone (CHEBI:51689) |
| butremycin (CHEBI:152570) is a lactam (CHEBI:24995) |
| butremycin (CHEBI:152570) is a organic heteropentacyclic compound (CHEBI:38164) |
| butremycin (CHEBI:152570) is a polyketide (CHEBI:26188) |
| IUPAC Name |
|---|
| (2R,3R,3aS,5aR,5bS,7Z,13R,14S,19E,20aS,21aR,21bR)-3-ethyl-13,22-dihydroxy-2-methyl-2,3,3a,5a,5b,6,10,11,12,13,14,15,20a,21,21a,21b-hexadecahydro-1H-14,17-(metheno)-as-indaceno[3,2-k][1,6]diazacycloheptadecine-9,16,18(17H)-trione |
| Citations |
|---|