EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15NO3.C7H6O3 |
| Net Charge | 0 |
| Average Mass | 287.312 |
| Monoisotopic Mass | 287.13689 |
| SMILES | O=C(O)c1ccccc1O.OCCN(CCO)CCO |
| InChI | InChI=1S/C7H6O3.C6H15NO3/c8-6-4-2-1-3-5(6)7(9)10;8-4-1-7(2-5-9)3-6-10/h1-4,8H,(H,9,10);8-10H,1-6H2 |
| InChIKey | UEVAMYPIMMOEFW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trolamine salicylate (CHEBI:752545) has functional parent salicylic acid (CHEBI:16914) |
| trolamine salicylate (CHEBI:752545) is a hydroxybenzoic acid (CHEBI:24676) |
| Synonyms | Source |
|---|---|
| Neo heliopan ts | ChEMBL |
| Neotan w | ChEMBL |
| Tea-salicylate | ChEMBL |
| Triethanolamine salicylate | ChEMBL |
| Trolamine salicylate | ChEMBL |