EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22O8 |
| Net Charge | 0 |
| Average Mass | 414.410 |
| Monoisotopic Mass | 414.13147 |
| SMILES | [H][C@@]12C(=O)OC[C@]1([H])[C@@H](O)c1cc3c(cc1[C@H]2c1cc(OC)c(OC)c(OC)c1)OCO3 |
| InChI | InChI=1S/C22H22O8/c1-25-16-4-10(5-17(26-2)21(16)27-3)18-11-6-14-15(30-9-29-14)7-12(11)20(23)13-8-28-22(24)19(13)18/h4-7,13,18-20,23H,8-9H2,1-3H3/t13-,18+,19+,20-/m0/s1 |
| InChIKey | YJGVMLPVUAXIQN-HAEOHBJNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Podophyllum peltatum (ncbitaxon:35933) | root (BTO:0001188) | Article (Book: American Medicinal Plants by Charles F. Millspaugh (Nov. 1974)) |
| Roles Classification |
|---|
| Biological Roles: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. insulin-like growth factor receptor 1 antagonist An antagonist at the insulin-like growth factor receptor 1. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| picropodophyllotoxin (CHEBI:75251) has role antineoplastic agent (CHEBI:35610) |
| picropodophyllotoxin (CHEBI:75251) has role insulin-like growth factor receptor 1 antagonist (CHEBI:75252) |
| picropodophyllotoxin (CHEBI:75251) has role plant metabolite (CHEBI:76924) |
| picropodophyllotoxin (CHEBI:75251) has role tyrosine kinase inhibitor (CHEBI:38637) |
| picropodophyllotoxin (CHEBI:75251) is a furonaphthodioxole (CHEBI:50307) |
| picropodophyllotoxin (CHEBI:75251) is a lignan (CHEBI:25036) |
| picropodophyllotoxin (CHEBI:75251) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| (5R,5aS,8aR,9R)-9-hydroxy-5-(3,4,5-trimethoxyphenyl)-5,8,8a,9-tetrahydrofuro[3',4':6,7]naphtho[2,3-d][1,3]dioxol-6(5aH)-one |
| Synonym | Source |
|---|---|
| Picropodophyllin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00002619 | KNApSAcK |
| C10871 | KEGG COMPOUND |
| HMDB0031452 | HMDB |
| WO2012047172 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:99161 | Reaxys |
| CAS:477-47-4 | KEGG COMPOUND |
| CAS:477-47-4 | ChemIDplus |
| Citations |
|---|