EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H51N3O11 |
| Net Charge | 0 |
| Average Mass | 785.891 |
| Monoisotopic Mass | 785.35236 |
| SMILES | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(c5c(nc6cc(C)ccn65)c4c3C2=O)NC(=O)/C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C43H51N3O11/c1-19-14-16-46-28(18-19)44-32-29-30-37(50)25(7)40-31(29)41(52)43(9,57-40)55-17-15-27(54-10)22(4)39(56-26(8)47)24(6)36(49)23(5)35(48)20(2)12-11-13-21(3)42(53)45-33(34(32)46)38(30)51/h11-18,20,22-24,27,35-36,39,48-51H,1-10H3,(H,45,53)/b12-11+,17-15+,21-13-/t20-,22+,23+,24+,27-,35-,36+,39+,43-/m0/s1 |
| InChIKey | NZCRJKRKKOLAOJ-XRCRFVBUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral agent A substance that destroys or inhibits replication of viruses. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Applications: | antiparkinson drug A drug used in the treatment of Parkinson's disease. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. hepatoprotective agent Any compound that is able to prevent damage to the liver. anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. antiinfective agent A substance used in the prophylaxis or therapy of infectious diseases. antispasmodic drug A drug that suppresses spasms. These are usually caused by smooth muscle contraction, especially in tubular organs. The effect is to prevent spasms of the stomach, intestine or urinary bladder. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rifaximin (CHEBI:75246) has role anti-anaemic agent (CHEBI:75835) |
| rifaximin (CHEBI:75246) has role anti-HIV agent (CHEBI:64946) |
| rifaximin (CHEBI:75246) has role antibacterial agent (CHEBI:33282) |
| rifaximin (CHEBI:75246) has role antiinfective agent (CHEBI:35441) |
| rifaximin (CHEBI:75246) has role antimicrobial agent (CHEBI:33281) |
| rifaximin (CHEBI:75246) has role antineoplastic agent (CHEBI:35610) |
| rifaximin (CHEBI:75246) has role antiparkinson drug (CHEBI:48407) |
| rifaximin (CHEBI:75246) has role antispasmodic drug (CHEBI:53784) |
| rifaximin (CHEBI:75246) has role antiviral agent (CHEBI:22587) |
| rifaximin (CHEBI:75246) has role cardiovascular drug (CHEBI:35554) |
| rifaximin (CHEBI:75246) has role gastrointestinal drug (CHEBI:55324) |
| rifaximin (CHEBI:75246) has role hepatoprotective agent (CHEBI:62868) |
| rifaximin (CHEBI:75246) has role orphan drug (CHEBI:71031) |
| rifaximin (CHEBI:75246) is a acetate ester (CHEBI:47622) |
| rifaximin (CHEBI:75246) is a cyclic ketal (CHEBI:59779) |
| rifaximin (CHEBI:75246) is a lactam (CHEBI:24995) |
| rifaximin (CHEBI:75246) is a macrocycle (CHEBI:51026) |
| rifaximin (CHEBI:75246) is a organic heterohexacyclic compound (CHEBI:51914) |
| rifaximin (CHEBI:75246) is a rifamycins (CHEBI:26580) |
| rifaximin (CHEBI:75246) is a semisynthetic derivative (CHEBI:72588) |
| IUPAC Name |
|---|
| (2S,16Z,18E,20S,21S,22R,23R,24R,25S,26R,27S,28E)-5,6,21,23-tetrahydroxy-27-methoxy-2,4,11,16,20,22,24,26-octamethyl-1,15-dioxo-1,2-dihydro-2,7-(epoxypentadeca[1,11,13]trienoimino)furo[2'',3'':7',8']naphtho[1',2':4,5]imidazo[1,2-a]pyridin-25-yl acetate |
| INNs | Source |
|---|---|
| rifaximin | KEGG DRUG |
| rifaximina | DrugBank |
| rifaximine | DrugBank |
| rifaximinun | DrugBank |
| Synonyms | Source |
|---|---|
| L-105 | ChEMBL |
| NSC-758957 | ChEMBL |
| Rifamycin L 105 | DrugBank |
| Rifamycin L 105SV | DrugBank |
| Rifaxidin | DrugBank |
| Brand Names | Source |
|---|---|
| Normix | ChEMBL |
| Rifacol | ChEMBL |
| Targaxan | ChEMBL |
| Xifaxanta | ChEMBL |
| Xifaxsan | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 2379 | DrugCentral |
| D02554 | KEGG DRUG |
| DB01220 | DrugBank |
| HMDB0015351 | HMDB |
| Rifaximin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7790802 | Reaxys |
| CAS:80621-81-4 | KEGG DRUG |
| CAS:80621-81-4 | ChemIDplus |
| Citations |
|---|