EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H51N3O11 |
| Net Charge | 0 |
| Average Mass | 785.891 |
| Monoisotopic Mass | 785.35236 |
| SMILES | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(c5c(nc6cc(C)ccn65)c4c3C2=O)NC(=O)/C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C43H51N3O11/c1-19-14-16-46-28(18-19)44-32-29-30-37(50)25(7)40-31(29)41(52)43(9,57-40)55-17-15-27(54-10)22(4)39(56-26(8)47)24(6)36(49)23(5)35(48)20(2)12-11-13-21(3)42(53)45-33(34(32)46)38(30)51/h11-18,20,22-24,27,35-36,39,48-51H,1-10H3,(H,45,53)/b12-11+,17-15+,21-13-/t20-,22+,23+,24+,27-,35-,36+,39+,43-/m0/s1 |
| InChIKey | NZCRJKRKKOLAOJ-XRCRFVBUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rifaximin (CHEBI:75246) has role antimicrobial agent (CHEBI:33281) |
| rifaximin (CHEBI:75246) has role gastrointestinal drug (CHEBI:55324) |
| rifaximin (CHEBI:75246) has role orphan drug (CHEBI:71031) |
| rifaximin (CHEBI:75246) is a acetate ester (CHEBI:47622) |
| rifaximin (CHEBI:75246) is a cyclic ketal (CHEBI:59779) |
| rifaximin (CHEBI:75246) is a lactam (CHEBI:24995) |
| rifaximin (CHEBI:75246) is a macrocycle (CHEBI:51026) |
| rifaximin (CHEBI:75246) is a organic heterohexacyclic compound (CHEBI:51914) |
| rifaximin (CHEBI:75246) is a rifamycins (CHEBI:26580) |
| rifaximin (CHEBI:75246) is a semisynthetic derivative (CHEBI:72588) |
| IUPAC Name |
|---|
| (2S,16Z,18E,20S,21S,22R,23R,24R,25S,26R,27S,28E)-5,6,21,23-tetrahydroxy-27-methoxy-2,4,11,16,20,22,24,26-octamethyl-1,15-dioxo-1,2-dihydro-2,7-(epoxypentadeca[1,11,13]trienoimino)furo[2'',3'':7',8']naphtho[1',2':4,5]imidazo[1,2-a]pyridin-25-yl acetate |
| INNs | Source |
|---|---|
| rifaximin | KEGG DRUG |
| rifaximina | DrugBank |
| rifaximine | DrugBank |
| rifaximinun | DrugBank |
| Synonyms | Source |
|---|---|
| Rifamycin L 105 | DrugBank |
| Rifamycin L 105SV | DrugBank |
| Rifaxidin | DrugBank |
| Brand Name | Source |
|---|---|
| Xifaxsan | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 2379 | DrugCentral |
| D02554 | KEGG DRUG |
| DB01220 | DrugBank |
| HMDB0015351 | HMDB |
| Rifaximin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7790802 | Reaxys |
| CAS:80621-81-4 | ChemIDplus |
| CAS:80621-81-4 | KEGG DRUG |
| Citations |
|---|