EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H51N3O11 |
| Net Charge | 0 |
| Average Mass | 785.891 |
| Monoisotopic Mass | 785.35236 |
| SMILES | CO[C@H]1/C=C/O[C@@]2(C)Oc3c(C)c(O)c4c(O)c(c5c(nc6cc(C)ccn65)c4c3C2=O)NC(=O)/C(C)=C\C=C\[C@H](C)[C@H](O)[C@@H](C)[C@@H](O)[C@@H](C)[C@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C43H51N3O11/c1-19-14-16-46-28(18-19)44-32-29-30-37(50)25(7)40-31(29)41(52)43(9,57-40)55-17-15-27(54-10)22(4)39(56-26(8)47)24(6)36(49)23(5)35(48)20(2)12-11-13-21(3)42(53)45-33(34(32)46)38(30)51/h11-18,20,22-24,27,35-36,39,48-51H,1-10H3,(H,45,53)/b12-11+,17-15+,21-13-/t20-,22+,23+,24+,27-,35-,36+,39+,43-/m0/s1 |
| InChIKey | NZCRJKRKKOLAOJ-XRCRFVBUSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | orphan drug Any drug that has been developed specifically for treatment of a rare medical condition, the condition itself being known as an orphan disease. gastrointestinal drug A drug used for its effects on the gastrointestinal system, e.g. controlling gastric acidity, regulating gastrointestinal motility and water flow, and improving digestion. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rifaximin (CHEBI:75246) has role antimicrobial agent (CHEBI:33281) |
| rifaximin (CHEBI:75246) has role gastrointestinal drug (CHEBI:55324) |
| rifaximin (CHEBI:75246) has role orphan drug (CHEBI:71031) |
| rifaximin (CHEBI:75246) is a acetate ester (CHEBI:47622) |
| rifaximin (CHEBI:75246) is a cyclic ketal (CHEBI:59779) |
| rifaximin (CHEBI:75246) is a lactam (CHEBI:24995) |
| rifaximin (CHEBI:75246) is a macrocycle (CHEBI:51026) |
| rifaximin (CHEBI:75246) is a organic heterohexacyclic compound (CHEBI:51914) |
| rifaximin (CHEBI:75246) is a rifamycins (CHEBI:26580) |
| rifaximin (CHEBI:75246) is a semisynthetic derivative (CHEBI:72588) |
| IUPAC Name |
|---|
| (2S,16Z,18E,20S,21S,22R,23R,24R,25S,26R,27S,28E)-5,6,21,23-tetrahydroxy-27-methoxy-2,4,11,16,20,22,24,26-octamethyl-1,15-dioxo-1,2-dihydro-2,7-(epoxypentadeca[1,11,13]trienoimino)furo[2'',3'':7',8']naphtho[1',2':4,5]imidazo[1,2-a]pyridin-25-yl acetate |
| INNs | Source |
|---|---|
| rifaximin | KEGG DRUG |
| rifaximina | DrugBank |
| rifaximinun | DrugBank |
| rifaximine | DrugBank |
| Synonyms | Source |
|---|---|
| Rifaxidin | DrugBank |
| Rifamycin L 105SV | DrugBank |
| Rifamycin L 105 | DrugBank |
| Brand Name | Source |
|---|---|
| Xifaxsan | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D02554 | KEGG DRUG |
| DB01220 | DrugBank |
| HMDB0015351 | HMDB |
| Rifaximin | Wikipedia |
| 2379 | DrugCentral |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7790802 | Reaxys |
| CAS:80621-81-4 | KEGG DRUG |
| CAS:80621-81-4 | ChemIDplus |
| Citations |
|---|