EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | BrO3.Na |
| Net Charge | 0 |
| Average Mass | 150.891 |
| Monoisotopic Mass | 149.89285 |
| SMILES | O=Br(=O)[O-].[Na+] |
| InChI | InChI=1S/BrHO3.Na/c2-1(3)4;/h(H,2,3,4);/q;+1/p-1 |
| InChIKey | XUXNAKZDHHEHPC-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Role: | nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sodium bromate (CHEBI:75229) has role nephrotoxic agent (CHEBI:50909) |
| sodium bromate (CHEBI:75229) has role oxidising agent (CHEBI:63248) |
| sodium bromate (CHEBI:75229) is a bromate salt (CHEBI:22923) |
| sodium bromate (CHEBI:75229) is a inorganic sodium salt (CHEBI:38702) |
| IUPAC Name |
|---|
| sodium bromate |
| Synonyms | Source |
|---|---|
| Bromate de sodium | ChemIDplus |
| Bromic acid, sodium salt | ChemIDplus |
| NaBrO3 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Sodium_bromate | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11343076 | Reaxys |
| CAS:7789-38-0 | ChemIDplus |
| Citations |
|---|