EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:751997 - mecrylate
| Formula | C5H5NO2 |
| Net Charge | 0 |
| Average Mass | 111.100 |
| Monoisotopic Mass | 111.03203 |
| SMILES | C=C(C#N)C(=O)OC |
| InChI | InChI=1S/C5H5NO2/c1-4(3-6)5(7)8-2/h1H2,2H3 |
| InChIKey | MWCLLHOVUTZFKS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | vulnerary A drug used in treating and healing of wounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mecrylate (CHEBI:751997) has role vulnerary (CHEBI:73336) |
| mecrylate (CHEBI:751997) is a nitrile (CHEBI:18379) |
| mecrylate (CHEBI:751997) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| INNs | Source |
|---|---|
| mecrilate | WHO MedNet |
| mecrilato | WHO MedNet |
| Synonyms | Source |
|---|---|
| Aron alpha a | ChEMBL |
| Cyanoacrylate | ChEMBL |
| Mecrylate | ChEMBL |
| Methyl cyanoacrylate | ChEMBL |