EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11F3N2O5 |
| Net Charge | 0 |
| Average Mass | 296.201 |
| Monoisotopic Mass | 296.06201 |
| SMILES | O=c1nc(=O)n([C@H]2C[C@H](O)[C@@H](CO)O2)cc1C(F)(F)F |
| InChI | InChI=1S/C10H11F3N2O5/c11-10(12,13)4-2-15(9(19)14-8(4)18)7-1-5(17)6(3-16)20-7/h2,5-7,16-17H,1,3H2,(H,14,18,19)/t5-,6+,7+/m0/s1 |
| InChIKey | VSQQQLOSPVPRAZ-RRKCRQDMSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. EC 2.1.1.45 (thymidylate synthase) inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of thymidylate synthase (EC 2.1.1.45). antimetabolite A substance which is structurally similar to a metabolite but which competes with it or replaces it, and so prevents or reduces its normal utilization. |
| Applications: | antiviral drug A substance used in the prophylaxis or therapy of virus diseases. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trifluridine (CHEBI:75179) has role antimetabolite (CHEBI:35221) |
| trifluridine (CHEBI:75179) has role antineoplastic agent (CHEBI:35610) |
| trifluridine (CHEBI:75179) has role antiviral drug (CHEBI:36044) |
| trifluridine (CHEBI:75179) has role EC 2.1.1.45 (thymidylate synthase) inhibitor (CHEBI:63720) |
| trifluridine (CHEBI:75179) is a nucleoside analogue (CHEBI:60783) |
| trifluridine (CHEBI:75179) is a organofluorine compound (CHEBI:37143) |
| trifluridine (CHEBI:75179) is a pyrimidine 2'-deoxyribonucleoside (CHEBI:19255) |
| Incoming Relation(s) |
| Lonsurf (CHEBI:90876) has part trifluridine (CHEBI:75179) |
| IUPAC Name |
|---|
| 2'-deoxy-5-(trifluoromethyl)uridine |
| INNs | Source |
|---|---|
| trifluridina | DrugBank |
| trifluridine | WHO MedNet |
| trifluridine | DrugBank |
| trifluridinum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 5-Trifluoromethyl-2-deoxyuridine | ChemIDplus |
| 5-(Trifluoromethyl)deoxyuridine | ChemIDplus |
| Trifluoromethyldeoxyuridine | DrugBank |
| Trifluorothymidine | DrugBank |
| trifluorothymine deoxyriboside | DrugBank |
| Brand Name | Source |
|---|---|
| Viroptic | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 2743 | DrugCentral |
| D00391 | KEGG DRUG |
| DB00432 | DrugBank |
| HMDB0014576 | HMDB |
| LSM-5217 | LINCS |
| Trifluridine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:568095 | Reaxys |
| CAS:70-00-8 | KEGG DRUG |
| CAS:70-00-8 | ChemIDplus |
| Citations |
|---|