EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | CH4N2O.H2O2 |
| Net Charge | 0 |
| Average Mass | 94.070 |
| Monoisotopic Mass | 94.03784 |
| SMILES | NC(N)=O.OO |
| InChI | InChI=1S/CH4N2O.H2O2/c2-1(3)4;1-2/h(H4,2,3,4);1-2H |
| InChIKey | AQLJVWUFPCUVLO-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | oxidising agent A substance that removes electrons from another reactant in a redox reaction. |
| Biological Role: | disinfectant An antimicrobial agent that is applied to non-living objects to destroy harmful microorganisms or to inhibit their activity. |
| Application: | reagent A substance used in a chemical reaction to detect, measure, examine, or produce other substances. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| urea hydrogen peroxide (CHEBI:75178) has part hydrogen peroxide (CHEBI:16240) |
| urea hydrogen peroxide (CHEBI:75178) has part urea (CHEBI:16199) |
| urea hydrogen peroxide (CHEBI:75178) has role disinfectant (CHEBI:48219) |
| urea hydrogen peroxide (CHEBI:75178) has role oxidising agent (CHEBI:63248) |
| urea hydrogen peroxide (CHEBI:75178) has role reagent (CHEBI:33893) |
| urea hydrogen peroxide (CHEBI:75178) is a mixture (CHEBI:60004) |
| Synonyms | Source |
|---|---|
| Urea peroxide | ChemIDplus |
| Carbamide peroxide | ChemIDplus |
| Urea hydroperoxide | ChemIDplus |
| Hydrogen peroxide carbamide | ChemIDplus |
| Urea compound with hydrogen peroxide (1:1) | ChemIDplus |
| Urea dioxide | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| Hydrogen_peroxide_-_urea | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3680414 | Reaxys |
| CAS:124-43-6 | ChemIDplus |