EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11N2O8P |
| Net Charge | 0 |
| Average Mass | 306.167 |
| Monoisotopic Mass | 306.02530 |
| SMILES | O=c1ccn([C@@H]2O[C@@H]3COP(=O)(O)O[C@H]3[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H11N2O8P/c12-5-1-2-11(9(14)10-5)8-6(13)7-4(18-8)3-17-20(15,16)19-7/h1-2,4,6-8,13H,3H2,(H,15,16)(H,10,12,14)/t4-,6-,7-,8-/m1/s1 |
| InChIKey | NXIHNBWNDCFCGL-XVFCMESISA-N |
| Roles Classification |
|---|
| Biological Roles: | signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. mammalian metabolite Any animal metabolite produced during a metabolic reaction in mammals. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',5'-cyclic UMP (CHEBI:75175) has role bacterial metabolite (CHEBI:76969) |
| 3',5'-cyclic UMP (CHEBI:75175) has role mammalian metabolite (CHEBI:75768) |
| 3',5'-cyclic UMP (CHEBI:75175) has role signalling molecule (CHEBI:62488) |
| 3',5'-cyclic UMP (CHEBI:75175) is a 3',5'-cyclic pyrimidine nucleotide (CHEBI:19835) |
| 3',5'-cyclic UMP (CHEBI:75175) is conjugate acid of 3',5'-cyclic UMP(1−) (CHEBI:184387) |
| Incoming Relation(s) |
| 3',5'-cyclic UMP(1−) (CHEBI:184387) is conjugate base of 3',5'-cyclic UMP (CHEBI:75175) |
| IUPAC Name |
|---|
| uridine 3',5'-(hydrogen phosphate) |
| Synonyms | Source |
|---|---|
| 3',5'-cUMP | ChEBI |
| 3',5'-cyclic UMP | ChEBI |
| cUMP | ChemIDplus |
| Cyclic 3',5'-uridine monophosphate | ChemIDplus |
| Cyclic ump | ChemIDplus |
| Uridine, cyclic 3',5'-(hydrogen phosphate) | ChemIDplus |
| Citations |
|---|