EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10N2O8P |
| Net Charge | -1 |
| Average Mass | 305.159 |
| Monoisotopic Mass | 305.01803 |
| SMILES | O=c1ccn([C@@H]2O[C@@H]3COP(=O)([O-])O[C@H]3[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C9H11N2O8P/c12-5-1-2-11(9(14)10-5)8-6(13)7-4(18-8)3-17-20(15,16)19-7/h1-2,4,6-8,13H,3H2,(H,15,16)(H,10,12,14)/p-1/t4-,6-,7-,8-/m1/s1 |
| InChIKey | NXIHNBWNDCFCGL-XVFCMESISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',5'-cyclic UMP(1−) (CHEBI:184387) is a organophosphate oxoanion (CHEBI:58945) |
| 3',5'-cyclic UMP(1−) (CHEBI:184387) is conjugate base of 3',5'-cyclic UMP (CHEBI:75175) |
| Incoming Relation(s) |
| 3',5'-cyclic UMP (CHEBI:75175) is conjugate acid of 3',5'-cyclic UMP(1−) (CHEBI:184387) |
| UniProt Name | Source |
|---|---|
| 3',5'-cyclic UMP | UniProt |