EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | Ca.C7H6NO3.C7H6NO3 |
| Net Charge | 0 |
| Average Mass | 344.336 |
| Monoisotopic Mass | 344.03213 |
| SMILES | Nc1ccc(C(=O)[O-])c(O)c1.Nc1ccc(C(=O)[O-])c(O)c1.[Ca+2] |
| InChI | InChI=1S/2C7H7NO3.Ca/c2*8-4-1-2-5(7(10)11)6(9)3-4;/h2*1-3,9H,8H2,(H,10,11);/q;;+2/p-2 |
| InChIKey | XDWVNCOPMIEDJK-UHFFFAOYSA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminosalicylate calcium (CHEBI:751730) has functional parent salicylic acid (CHEBI:16914) |
| aminosalicylate calcium (CHEBI:751730) has role antitubercular agent (CHEBI:33231) |
| aminosalicylate calcium (CHEBI:751730) is a hydroxybenzoic acid (CHEBI:24676) |
| Synonyms | Source |
|---|---|
| Aminosalicylate calcium anhydrous | ChEMBL |
| Aminosalicylate calcium trihydate | ChEMBL |
| Anhydrous calcium aminosalicylate | ChEMBL |
| Brand Name | Source |
|---|---|
| Nippas calcium | ChEMBL |