EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28O2 |
| Net Charge | 0 |
| Average Mass | 240.387 |
| Monoisotopic Mass | 240.20893 |
| SMILES | CCCC/C=C\CCCCCCCCC(=O)O |
| InChI | InChI=1S/C15H28O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17/h5-6H,2-4,7-14H2,1H3,(H,16,17)/b6-5- |
| InChIKey | APXSAEQXOXTDAM-WAYWQWQTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cis-10-pentadecenoic acid (CHEBI:75089) has role metabolite (CHEBI:25212) |
| cis-10-pentadecenoic acid (CHEBI:75089) is a 10-pentadecenoic acid (CHEBI:75087) |
| Incoming Relation(s) |
| methyl cis-10-pentadecenoate (CHEBI:144350) has functional parent cis-10-pentadecenoic acid (CHEBI:75089) |
| IUPAC Name |
|---|
| (10Z)-pentadec-10-enoic acid |
| Synonyms | Source |
|---|---|
| 10Z-pentadecenoic acid | LIPID MAPS |
| 15:1 n-5 cis | ChEBI |
| C15:1 n-5 cis | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA01030259 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5926208 | Reaxys |