EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30O2 |
| Net Charge | 0 |
| Average Mass | 254.414 |
| Monoisotopic Mass | 254.22458 |
| SMILES | CCCC/C=C\CCCCCCCCC(=O)OC |
| InChI | InChI=1S/C16H30O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18-2/h6-7H,3-5,8-15H2,1-2H3/b7-6- |
| InChIKey | JEDIPLFNJDRCFD-SREVYHEPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Gracilaria gracilis (ncbitaxon:2777) | - | PubMed (24084791) | |
| Spirogyra porticalis (ncbitaxon:3179) | - | PubMed (30858387) |
| Roles Classification |
|---|
| Biological Role: | algal metabolite Any eukaryotic metabolite produced during a metabolic reaction in algae including unicellular organisms like chlorella and diatoms to multicellular organisms like giant kelps and brown algae. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl cis-10-pentadecenoate (CHEBI:144350) has functional parent cis-10-pentadecenoic acid (CHEBI:75089) |
| methyl cis-10-pentadecenoate (CHEBI:144350) has role algal metabolite (CHEBI:84735) |
| methyl cis-10-pentadecenoate (CHEBI:144350) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl (10Z)-pentadec-10-enoate |
| Synonyms | Source |
|---|---|
| cis-10-pentadecenoic acid methyl ester | ChEBI |
| methyl (Z)-pentadec-10-enoate | ChEBI |
| (Z)-10-pentadecenoic acid methyl ester | ChEBI |
| 10(Z)-pentadecenoic acid methyl ester | ChEBI |
| C15:1 (cis-10) methyl ester | ChEBI |
| methyl 10-cis-pentadecenoate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| CAS:90176-52-6 | ChEBI |
| Citations |
|---|