EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20F3N5O2S2.CH4O3S |
| Net Charge | 0 |
| Average Mass | 615.681 |
| Monoisotopic Mass | 615.08917 |
| SMILES | CC(C)(C)c1nc(-c2cccc(NS(=O)(=O)c3c(F)cccc3F)c2F)c(-c2ccnc(N)n2)s1.CS(=O)(=O)O |
| InChI | InChI=1S/C23H20F3N5O2S2.CH4O3S/c1-23(2,3)21-30-18(19(34-21)16-10-11-28-22(27)29-16)12-6-4-9-15(17(12)26)31-35(32,33)20-13(24)7-5-8-14(20)25;1-5(2,3)4/h4-11,31H,1-3H3,(H2,27,28,29);1H3,(H,2,3,4) |
| InChIKey | YKGMKSIHIVVYKY-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | B-Raf inhibitor A serine/threonine kinase inhibitor that specifically inhibits human mutant serine/threonine kinase (B-Raf) |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dabrafenib mesylate (CHEBI:75048) has part dabrafenib (CHEBI:75045) |
| dabrafenib mesylate (CHEBI:75048) has role antineoplastic agent (CHEBI:35610) |
| dabrafenib mesylate (CHEBI:75048) has role B-Raf inhibitor (CHEBI:75047) |
| dabrafenib mesylate (CHEBI:75048) is a methanesulfonate salt (CHEBI:38037) |
| dabrafenib mesylate (CHEBI:75048) is a organic molecular entity (CHEBI:50860) |
| dabrafenib mesylate (CHEBI:75048) is a sulfonamide (CHEBI:35358) |
| IUPAC Name |
|---|
| N-{3-[5-(2-aminopyrimidin-4-yl)-2-tert-butyl-1,3-thiazol-4-yl]-2-fluorophenyl}-2,6-difluorobenzenesulfonamide methanesulfonate |
| Synonyms | Source |
|---|---|
| dabrafenib monomesylate | ChEBI |
| GSK 2118436 | ChemIDplus |
| GSK 2118436B | ChemIDplus |
| GSK-2118436B | ChEMBL |
| GSK-2118436B MESYLATE | ChEMBL |
| GSK-2118436B METHANESULFONATE SALT | ChEMBL |
| Brand Names | Source |
|---|---|
| Finlee | ChEMBL |
| Tafinlar | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| D10104 | KEGG DRUG |
| Dabrafenib | Wikipedia |
| WO2011047238 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19690182 | Reaxys |
| CAS:1195768-06-9 | ChemIDplus |
| CAS:1195768-06-9 | KEGG DRUG |
| Citations |
|---|