EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H20F3N5O2S2 |
| Net Charge | 0 |
| Average Mass | 519.574 |
| Monoisotopic Mass | 519.10105 |
| SMILES | CC(C)(C)c1nc(-c2cccc(NS(=O)(=O)c3c(F)cccc3F)c2F)c(-c2ccnc(N)n2)s1 |
| InChI | InChI=1S/C23H20F3N5O2S2/c1-23(2,3)21-30-18(19(34-21)16-10-11-28-22(27)29-16)12-6-4-9-15(17(12)26)31-35(32,33)20-13(24)7-5-8-14(20)25/h4-11,31H,1-3H3,(H2,27,28,29) |
| InChIKey | BFSMGDJOXZAERB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. B-Raf inhibitor A serine/threonine kinase inhibitor that specifically inhibits human mutant serine/threonine kinase (B-Raf) |
| Applications: | renoprotective agent Any compound that is able to prevent damage to the kidneys. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dabrafenib (CHEBI:75045) has role anticoronaviral agent (CHEBI:149553) |
| dabrafenib (CHEBI:75045) has role antineoplastic agent (CHEBI:35610) |
| dabrafenib (CHEBI:75045) has role B-Raf inhibitor (CHEBI:75047) |
| dabrafenib (CHEBI:75045) has role renoprotective agent (CHEBI:231911) |
| dabrafenib (CHEBI:75045) is a 1,3-thiazoles (CHEBI:38418) |
| dabrafenib (CHEBI:75045) is a aminopyrimidine (CHEBI:38338) |
| dabrafenib (CHEBI:75045) is a organofluorine compound (CHEBI:37143) |
| dabrafenib (CHEBI:75045) is a sulfonamide (CHEBI:35358) |
| Incoming Relation(s) |
| dabrafenib mesylate (CHEBI:75048) has part dabrafenib (CHEBI:75045) |
| IUPAC Name |
|---|
| N-{3-[5-(2-aminopyrimidin-4-yl)-2-tert-butyl-1,3-thiazol-4-yl]-2-fluorophenyl}-2,6-difluorobenzenesulfonamide |
| INN | Source |
|---|---|
| dabrafenib | ChemIDplus |
| Synonyms | Source |
|---|---|
| GSK-2118436 | ChEMBL |
| GSK-2118436A | ChEMBL |
| GSK2118436A | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4801 | DrugCentral |
| D10064 | KEGG DRUG |
| Dabrafenib | Wikipedia |
| LSM-6303 | LINCS |
| WO2011047238 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19689971 | Reaxys |
| CAS:1195765-45-7 | ChemIDplus |
| Citations |
|---|