EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:750448 - aminosalicylate sodium
| Formula | H2O.C7H6NO3.Na.H2O |
| Net Charge | 0 |
| Average Mass | 211.149 |
| Monoisotopic Mass | 211.04567 |
| SMILES | Nc1ccc(C(=O)[O-])c(O)c1.O.O.[Na+] |
| InChI | InChI=1S/C7H7NO3.Na.2H2O/c8-4-1-2-5(7(10)11)6(9)3-4;;;/h1-3,9H,8H2,(H,10,11);;2*1H2/q;+1;;/p-1 |
| InChIKey | GMUQJDAYXZXBOT-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| Application: | antitubercular agent A substance that kills or slows the growth of Mycobacterium tuberculosis and is used in the treatment of tuberculosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminosalicylate sodium (CHEBI:750448) has functional parent salicylic acid (CHEBI:16914) |
| aminosalicylate sodium (CHEBI:750448) has role antitubercular agent (CHEBI:33231) |
| aminosalicylate sodium (CHEBI:750448) is a hydroxybenzoic acid (CHEBI:24676) |
| Synonyms | Source |
|---|---|
| Aminacyl | ChEMBL |
| Aminosalicylate sodium | ChEMBL |
| Aminosalyle sodium | ChEMBL |
| Nemasol sodium | ChEMBL |
| NSC-755862 | ChEMBL |
| Para-aminosodium salicylate | ChEMBL |
| Brand Names | Source |
|---|---|
| Parasal sodium | ChEMBL |
| P.a.s. sodium | ChEMBL |
| Sodium p.a.s. | ChEMBL |
| Citations |
|---|