EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:74992 - rhamnetin
| Formula | C16H12O7 |
| Net Charge | 0 |
| Average Mass | 316.265 |
| Monoisotopic Mass | 316.05830 |
| SMILES | COc1cc(O)c2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C16H12O7/c1-22-8-5-11(19)13-12(6-8)23-16(15(21)14(13)20)7-2-3-9(17)10(18)4-7/h2-6,17-19,21H,1H3 |
| InChIKey | JGUZGNYPMHHYRK-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhamnetin (CHEBI:74992) has functional parent quercetin (CHEBI:16243) |
| rhamnetin (CHEBI:74992) has role anti-inflammatory agent (CHEBI:67079) |
| rhamnetin (CHEBI:74992) has role antioxidant (CHEBI:22586) |
| rhamnetin (CHEBI:74992) has role metabolite (CHEBI:25212) |
| rhamnetin (CHEBI:74992) is a monomethoxyflavone (CHEBI:25401) |
| rhamnetin (CHEBI:74992) is a tetrahydroxyflavone (CHEBI:38684) |
| rhamnetin (CHEBI:74992) is conjugate acid of rhamnetin-3-olate (CHEBI:192706) |
| Incoming Relation(s) |
| rhamnetin-3-olate (CHEBI:192706) is conjugate base of rhamnetin (CHEBI:74992) |
| Synonyms | Source |
|---|---|
| 3,3',4',5-Tetrahydroxy-7-methoxyflavone | ChemIDplus |
| 3,5,3',4'-Tetrahydroxy-7-methoxyflavone | LIPID MAPS |
| 7-Methoxyquercetin | LIPID MAPS |
| 7-Methylquercetin | ChemIDplus |
| 7-O-Methylquercetin | ChemIDplus |
| beta-Rhamnocitrin | ChemIDplus |
| Citations |
|---|