EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H11O7 |
| Net Charge | -1 |
| Average Mass | 315.257 |
| Monoisotopic Mass | 315.05103 |
| SMILES | COc1cc(O)c2c(=O)c([O-])c(-c3ccc(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C16H12O7/c1-22-8-5-11(19)13-12(6-8)23-16(15(21)14(13)20)7-2-3-9(17)10(18)4-7/h2-6,17-19,21H,1H3/p-1 |
| InChIKey | JGUZGNYPMHHYRK-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| rhamnetin-3-olate (CHEBI:192706) is a flavonol oxoanion (CHEBI:58588) |
| rhamnetin-3-olate (CHEBI:192706) is conjugate base of rhamnetin (CHEBI:74992) |
| Incoming Relation(s) |
| rhamnetin (CHEBI:74992) is conjugate acid of rhamnetin-3-olate (CHEBI:192706) |
| Synonym | Source |
|---|---|
| 7-methylquercetin-3-olate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| rhamnetin | UniProt |
| Citations |
|---|