EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12NO6P |
| Net Charge | 0 |
| Average Mass | 261.170 |
| Monoisotopic Mass | 261.04022 |
| SMILES | N[C@H](Cc1ccc(OP(=O)(O)O)cc1)C(=O)O |
| InChI | InChI=1S/C9H12NO6P/c10-8(9(11)12)5-6-1-3-7(4-2-6)16-17(13,14)15/h1-4,8H,5,10H2,(H,11,12)(H2,13,14,15)/t8-/m1/s1 |
| InChIKey | DCWXELXMIBXGTH-MRVPVSSYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O4-phospho-D-tyrosine (CHEBI:74959) is a O4-phosphotyrosine (CHEBI:74956) |
| O4-phospho-D-tyrosine (CHEBI:74959) is a D-tyrosine derivative (CHEBI:84124) |
| O4-phospho-D-tyrosine (CHEBI:74959) is a D-α-amino acid (CHEBI:16733) |
| O4-phospho-D-tyrosine (CHEBI:74959) is a aromatic amino acid (CHEBI:33856) |
| O4-phospho-D-tyrosine (CHEBI:74959) is enantiomer of O4-phospho-L-tyrosine (CHEBI:37788) |
| Incoming Relation(s) |
| O4-phospho-L-tyrosine (CHEBI:37788) is enantiomer of O4-phospho-D-tyrosine (CHEBI:74959) |
| IUPAC Name |
|---|
| O-phosphono-D-tyrosine |
| Synonym | Source |
|---|---|
| O-phospho-D-tyrosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-3729 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:13579292 | Reaxys |