EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12NO6P |
| Net Charge | 0 |
| Average Mass | 261.170 |
| Monoisotopic Mass | 261.04022 |
| SMILES | N[C@@H](Cc1ccc(OP(=O)(O)O)cc1)C(=O)O |
| InChI | InChI=1S/C9H12NO6P/c10-8(9(11)12)5-6-1-3-7(4-2-6)16-17(13,14)15/h1-4,8H,5,10H2,(H,11,12)(H2,13,14,15)/t8-/m0/s1 |
| InChIKey | DCWXELXMIBXGTH-QMMMGPOBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | immunogen An antigen capable, on its own, of inducing an immune response. Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O4-phospho-L-tyrosine (CHEBI:37788) has role Escherichia coli metabolite (CHEBI:76971) |
| O4-phospho-L-tyrosine (CHEBI:37788) has role immunogen (CHEBI:60816) |
| O4-phospho-L-tyrosine (CHEBI:37788) is a O4-phosphotyrosine (CHEBI:74956) |
| O4-phospho-L-tyrosine (CHEBI:37788) is a L-tyrosine derivative (CHEBI:27177) |
| O4-phospho-L-tyrosine (CHEBI:37788) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| O4-phospho-L-tyrosine (CHEBI:37788) is conjugate acid of O4-phosphonato-L-tyrosine(2−) (CHEBI:62338) |
| O4-phospho-L-tyrosine (CHEBI:37788) is enantiomer of O4-phospho-D-tyrosine (CHEBI:74959) |
| Incoming Relation(s) |
| O4-phosphonato-L-tyrosine(2−) (CHEBI:62338) is conjugate base of O4-phospho-L-tyrosine (CHEBI:37788) |
| O4-phospho-D-tyrosine (CHEBI:74959) is enantiomer of O4-phospho-L-tyrosine (CHEBI:37788) |
| O4-phospho-L-tyrosine residue (CHEBI:61972) is substituent group from O4-phospho-L-tyrosine (CHEBI:37788) |
| IUPAC Name |
|---|
| O4-phosphono-L-tyrosine |
| Synonyms | Source |
|---|---|
| O-phosphono-L-tyrosine | ChEBI |
| O-phospho-L-tyrosine | ChEBI |
| O-phosphotyrosine | ChEBI |
| Phosphonotyrosine | KEGG COMPOUND |
| Phosphotyrosine | KEGG COMPOUND |
| tyrosine phosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3150815 | Reaxys |
| CAS:21820-51-9 | ChemIDplus |
| Citations |
|---|