EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H32ClN5O2.HCl |
| Net Charge | 0 |
| Average Mass | 506.478 |
| Monoisotopic Mass | 505.20113 |
| SMILES | CCc1nn(CCCN2CCN(c3cccc(Cl)c3)CC2)c(=O)n1CCOc1ccccc1.Cl |
| InChI | InChI=1S/C25H32ClN5O2.ClH/c1-2-24-27-31(25(32)30(24)18-19-33-23-10-4-3-5-11-23)13-7-12-28-14-16-29(17-15-28)22-9-6-8-21(26)20-22;/h3-6,8-11,20H,2,7,12-19H2,1H3;1H |
| InChIKey | DYCKFEBIOUQECE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nefazodone hydrochloride (CHEBI:7495) has part nefazodone (CHEBI:7494) |
| nefazodone hydrochloride (CHEBI:7495) has role antidepressant (CHEBI:35469) |
| nefazodone hydrochloride (CHEBI:7495) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 2-{3-[4-(3-chlorophenyl)piperazin-1-yl]propyl}-5-ethyl-4-(2-phenoxyethyl)-2,4-dihydro-3H-1,2,4-triazol-3-one hydrochloride |
| Synonyms | Source |
|---|---|
| 1-(3-(4-(m-Chlorophenyl)-1-piperazinyl)propyl)-3-ethyl-4-(2-phenoxyethyl)-delta(sup 2)-1,2,4-triazolin-5-one monohydrochloride | ChemIDplus |
| BMY 13754 | ChEMBL |
| BMY-13754 | ChEMBL |
| MJ 13,754-1 | ChEMBL |
| MJ-13754-1 | ChEMBL |
| Nefazodone HCl | ChEBI |
| Brand Name | Source |
|---|---|
| Dutonin | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| Beilstein:4636943 | Beilstein |
| CAS:82752-99-6 | ChemIDplus |