EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | K.C7H6NO3 |
| Net Charge | 0 |
| Average Mass | 191.227 |
| Monoisotopic Mass | 190.99847 |
| SMILES | Nc1ccc(C(=O)[O-])c(O)c1.[K+] |
| InChI | InChI=1S/C7H7NO3.K/c8-4-1-2-5(7(10)11)6(9)3-4;/h1-3,9H,8H2,(H,10,11);/q;+1/p-1 |
| InChIKey | PRZJIMSXCLZGLT-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| aminosalicylate potassium (CHEBI:749282) has functional parent salicylic acid (CHEBI:16914) |
| aminosalicylate potassium (CHEBI:749282) is a hydroxybenzoic acid (CHEBI:24676) |
| Synonyms | Source |
|---|---|
| P-aminosalicylic acid potassium salt | ChEMBL |
| Potassium aminosalicylate | ChEMBL |
| Brand Name | Source |
|---|---|
| Paskalium | ChEMBL |