EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:748765 - s-1360
| Formula | C16H12FN3O3 |
| Net Charge | 0 |
| Average Mass | 313.288 |
| Monoisotopic Mass | 313.08627 |
| SMILES | O=C(/C=C(\O)c1ncnn1)c1ccc(Cc2ccc(F)cc2)o1 |
| InChI | InChI=1S/C16H12FN3O3/c17-11-3-1-10(2-4-11)7-12-5-6-15(23-12)13(21)8-14(22)16-18-9-19-20-16/h1-6,8-9,22H,7H2,(H,18,19,20)/b14-8- |
| InChIKey | HFHDGHOGHWXXDT-ZSOIEALJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| s-1360 (CHEBI:748765) has role anti-HIV agent (CHEBI:64946) |
| s-1360 (CHEBI:748765) is a furoic acid (CHEBI:36055) |
| Synonyms | Source |
|---|---|
| GSK-S-1360 | ChEMBL |
| GW-810781 | ChEMBL |
| GW810781 | ChEMBL |
| S 1360 | ChEMBL |
| S-1360 | ChEMBL |
| Citations |
|---|