EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:747905 - (2S)-3-methylbutan-2-ol
| Formula | C5H12O |
| Net Charge | 0 |
| Average Mass | 88.150 |
| Monoisotopic Mass | 88.08882 |
| SMILES | CC(C)[C@H](C)O |
| InChI | InChI=1S/C5H12O/c1-4(2)5(3)6/h4-6H,1-3H3/t5-/m0/s1 |
| InChIKey | MXLMTQWGSQIYOW-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Role: | polar solvent A solvent that is composed of polar molecules. Polar solvents can dissolve ionic compounds or ionisable covalent compounds. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | polar solvent A solvent that is composed of polar molecules. Polar solvents can dissolve ionic compounds or ionisable covalent compounds. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-3-methylbutan-2-ol (CHEBI:747905) is a 3-methyl-2-butanol (CHEBI:77517) |
| UniProt Name | Source |
|---|---|
| (2S)-3-methylbutan-2-ol | UniProt |
| Citations |
|---|