EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H22FN7O |
| Net Charge | 0 |
| Average Mass | 419.464 |
| Monoisotopic Mass | 419.18699 |
| SMILES | CCn1ncc2c1-c1cnc(N)c(c1)O[C@H](C)c1cc(F)ccc1-c1nn(C)nc1C2 |
| InChI | InChI=1S/C22H22FN7O/c1-4-30-21-13(11-26-30)7-18-20(28-29(3)27-18)16-6-5-15(23)9-17(16)12(2)31-19-8-14(21)10-25-22(19)24/h5-6,8-12H,4,7H2,1-3H3,(H2,24,25)/t12-/m1/s1 |
| InChIKey | DTWUUAFTYSMNQX-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Biological Role: | tyrosine kinase inhibitor Any protein kinase inhibitor that interferes with the action of tyrosine kinase. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zidesamtinib (CHEBI:747901) has role antineoplastic agent (CHEBI:35610) |
| zidesamtinib (CHEBI:747901) has role tyrosine kinase inhibitor (CHEBI:38637) |