EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H20N2O7 |
| Net Charge | 0 |
| Average Mass | 460.442 |
| Monoisotopic Mass | 460.12705 |
| SMILES | COc1cc(/C=C/C(=O)/C=C/c2ccc3c(c2)C(=O)N(C2CCC(=O)NC2=O)C3=O)ccc1O |
| InChI | InChI=1S/C25H20N2O7/c1-34-21-13-15(5-10-20(21)29)3-7-16(28)6-2-14-4-8-17-18(12-14)25(33)27(24(17)32)19-9-11-22(30)26-23(19)31/h2-8,10,12-13,19,29H,9,11H2,1H3,(H,26,30,31)/b6-2+,7-3+ |
| InChIKey | HEMJTXBCAXHSBV-YPCIICBESA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-[2-(feruloyl)ethen-1-yl]thalidomide (CHEBI:74774) has functional parent thalidomide (CHEBI:9513) |
| 5-[2-(feruloyl)ethen-1-yl]thalidomide (CHEBI:74774) has role antineoplastic agent (CHEBI:35610) |
| 5-[2-(feruloyl)ethen-1-yl]thalidomide (CHEBI:74774) is a aromatic ether (CHEBI:35618) |
| 5-[2-(feruloyl)ethen-1-yl]thalidomide (CHEBI:74774) is a dicarboximide (CHEBI:35356) |
| 5-[2-(feruloyl)ethen-1-yl]thalidomide (CHEBI:74774) is a enone (CHEBI:51689) |
| 5-[2-(feruloyl)ethen-1-yl]thalidomide (CHEBI:74774) is a isoindoles (CHEBI:24897) |
| 5-[2-(feruloyl)ethen-1-yl]thalidomide (CHEBI:74774) is a phenols (CHEBI:33853) |
| 5-[2-(feruloyl)ethen-1-yl]thalidomide (CHEBI:74774) is a piperidones (CHEBI:48589) |
| IUPAC Name |
|---|
| 2-(2,6-dioxopiperidin-3-yl)-5-[(1E,4E)-5-(4-hydroxy-3-methoxyphenyl)-3-oxopenta-1,4-dien-1-yl]-1H-isoindole-1,3(2H)-dione |
| Synonym | Source |
|---|---|
| 5-[(1E,4E)-5-(4-hydroxy-3-methoxyphenyl)-3-oxopenta-1,4-dien-1-yl]thalidomide | ChEBI |
| Citations |
|---|