EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24NO3 |
| Net Charge | +1 |
| Average Mass | 266.361 |
| Monoisotopic Mass | 266.17507 |
| SMILES | C=CCOc1ccccc1OC[C@@H](O)C[NH2+]C(C)C |
| InChI | InChI=1S/C15H23NO3/c1-4-9-18-14-7-5-6-8-15(14)19-11-13(17)10-16-12(2)3/h4-8,12-13,16-17H,1,9-11H2,2-3H3/p+1/t13-/m0/s1 |
| InChIKey | CEMAWMOMDPGJMB-ZDUSSCGKSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-oxprenolol(1+) (CHEBI:747615) is a secondary ammonium ion (CHEBI:137419) |
| (S)-oxprenolol(1+) (CHEBI:747615) is conjugate acid of (S)-oxprenolol (CHEBI:747561) |
| (S)-oxprenolol(1+) (CHEBI:747615) is enantiomer of (R)-oxprenolol(1+) (CHEBI:747614) |
| Incoming Relation(s) |
| (S)-oxprenolol hydrochloride (CHEBI:747617) has part (S)-oxprenolol(1+) (CHEBI:747615) |
| (S)-oxprenolol (CHEBI:747561) is conjugate base of (S)-oxprenolol(1+) (CHEBI:747615) |
| (R)-oxprenolol(1+) (CHEBI:747614) is enantiomer of (S)-oxprenolol(1+) (CHEBI:747615) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-N-(propan-2-yl)-3-[2-(prop-2-en-1-yloxy)phenoxy]propan-1-aminium |
| Synonyms | Source |
|---|---|
| (S)-oxprenolol cation | ChEBI |
| (−)-oxprenolol cation | ChEBI |